C23H42O5Si2 — CID 23260562
(6S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethoxy-6-(1-trimethylsilyloxyethyl)-5,6,7,8-tetrahydronaphthalen-1-one (PubChem CID 23260562) has the molecular formula C23H42O5Si2 and a molecular weight of 454.76 g/mol. Its IUPAC name is (6S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethoxy-6-(1-trimethylsilyloxyethyl)-5,6,7,8-tetrahydronaphthalen-1-one.
| Compound Name | (6S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethoxy-6-(1-trimethylsilyloxyethyl)-5,6,7,8-tetrahydronaphthalen-1-one |
|---|---|
| PubChem CID | 23260562 |
| Molecular Formula | C23H42O5Si2 |
| Molecular Weight | 454.76 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | (6S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethoxy-6-(1-trimethylsilyloxyethyl)-5,6,7,8-tetrahydronaphthalen-1-one |
| SMILES | COC1(OC)C=CC(=O)C2=C1C[C@H](C(C)O[Si](C)(C)C)C[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H42O5Si2/c1-16(27-29(7,8)9)17-14-18-21(19(24)12-13-23(18,25-5)26-6)20(15-17)28-30(10,11)22(2,3)4/h12-13,16-17,20H,14-15H2,1-11H3/t16?,17-,20+/m0/s1 |
| InChIKey | ZEJIUNZPNJTYNV-KKOVZHJLSA-N |
| XLogP | 5.45 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.76 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|