C5H8Cl3O2P — CID 23262838
chloro-[(Z)-1,3-dichloroprop-1-en-2-yl]oxy-ethoxyphosphane (PubChem CID 23262838) has the molecular formula C5H8Cl3O2P and a molecular weight of 237.45 g/mol. Its IUPAC name is chloro-[(Z)-1,3-dichloroprop-1-en-2-yl]oxy-ethoxyphosphane.
| Compound Name | chloro-[(Z)-1,3-dichloroprop-1-en-2-yl]oxy-ethoxyphosphane |
|---|---|
| PubChem CID | 23262838 |
| Molecular Formula | C5H8Cl3O2P |
| Molecular Weight | 237.45 g/mol |
| Exact Mass | 235.93 |
| IUPAC Name | chloro-[(Z)-1,3-dichloroprop-1-en-2-yl]oxy-ethoxyphosphane |
| SMILES | CCOP(Cl)O/C(=C\Cl)CCl |
| InChI | InChI=1S/C5H8Cl3O2P/c1-2-9-11(8)10-5(3-6)4-7/h3H,2,4H2,1H3/b5-3- |
| InChIKey | NHUIPPFXPNYGMG-HYXAFXHYSA-N |
| XLogP | 3.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|