C6H6Cl5O3P — CID 2785374
1,3-dichloro-2-[chloro(1,3-dichloroprop-1-en-2-yloxy)phosphoryl]oxyprop-1-ene (PubChem CID 2785374) has the molecular formula C6H6Cl5O3P and a molecular weight of 334.35 g/mol. Its IUPAC name is 1,3-dichloro-2-[chloro(1,3-dichloroprop-1-en-2-yloxy)phosphoryl]oxyprop-1-ene.
| Compound Name | 1,3-dichloro-2-[chloro(1,3-dichloroprop-1-en-2-yloxy)phosphoryl]oxyprop-1-ene |
|---|---|
| PubChem CID | 2785374 |
| Molecular Formula | C6H6Cl5O3P |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 331.85 |
| IUPAC Name | 1,3-dichloro-2-[chloro(1,3-dichloroprop-1-en-2-yloxy)phosphoryl]oxyprop-1-ene |
| SMILES | O=P(Cl)(OC(=CCl)CCl)OC(=CCl)CCl |
| InChI | InChI=1S/C6H6Cl5O3P/c7-1-5(2-8)13-15(11,12)14-6(3-9)4-10/h1,3H,2,4H2 |
| InChIKey | MFHCJCSYHSBGOC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|