C11H20O2 — CID 23264745
(Z)-1-hydroxy-2,7,7-trimethyloct-1-en-3-one (PubChem CID 23264745) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (Z)-1-hydroxy-2,7,7-trimethyloct-1-en-3-one.
| Compound Name | (Z)-1-hydroxy-2,7,7-trimethyloct-1-en-3-one |
|---|---|
| PubChem CID | 23264745 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (Z)-1-hydroxy-2,7,7-trimethyloct-1-en-3-one |
| SMILES | C/C(=C/O)C(=O)CCCC(C)(C)C |
| InChI | InChI=1S/C11H20O2/c1-9(8-12)10(13)6-5-7-11(2,3)4/h8,12H,5-7H2,1-4H3/b9-8- |
| InChIKey | PWGJFOHXERNEEL-HJWRWDBZSA-N |
| XLogP | 3.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|