C22H36O4 — CID 23266101
[(4E,7R,8S,9E,11S)-8-hydroxy-4,8,14-trimethyl-11-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,9-dien-7-yl] acetate (PubChem CID 23266101) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is [(4E,7R,8S,9E,11S)-8-hydroxy-4,8,14-trimethyl-11-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,9-dien-7-yl] acetate.
| Compound Name | [(4E,7R,8S,9E,11S)-8-hydroxy-4,8,14-trimethyl-11-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,9-dien-7-yl] acetate |
|---|---|
| PubChem CID | 23266101 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | [(4E,7R,8S,9E,11S)-8-hydroxy-4,8,14-trimethyl-11-propan-2-yl-15-oxabicyclo[12.1.0]pentadeca-4,9-dien-7-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C/C=C(\C)CCC2OC2(C)CC[C@@H](C(C)C)/C=C/[C@]1(C)O |
| InChI | InChI=1S/C22H36O4/c1-15(2)18-11-13-21(5,24)19(25-17(4)23)9-7-16(3)8-10-20-22(6,26-20)14-12-18/h7,11,13,15,18-20,24H,8-10,12,14H2,1-6H3/b13-11+,16-7+/t18-,19+,20?,21-,22?/m0/s1 |
| InChIKey | YHSWWAKFVQHFHC-DPBYPFFOSA-N |
| XLogP | 4.57 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|