C20H32O3 — CID 5250430
5,10,16-trimethyl-13-propan-2-yl-4,9,17-trioxatetracyclo[14.1.0.03,5.08,10]heptadec-14-ene (PubChem CID 5250430) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 5,10,16-trimethyl-13-propan-2-yl-4,9,17-trioxatetracyclo[14.1.0.03,5.08,10]heptadec-14-ene.
| Compound Name | 5,10,16-trimethyl-13-propan-2-yl-4,9,17-trioxatetracyclo[14.1.0.03,5.08,10]heptadec-14-ene |
|---|---|
| PubChem CID | 5250430 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 5,10,16-trimethyl-13-propan-2-yl-4,9,17-trioxatetracyclo[14.1.0.03,5.08,10]heptadec-14-ene |
| SMILES | CC(C)C1C=CC2(C)OC2CC2OC2(C)CCC2OC2(C)CC1 |
| InChI | InChI=1S/C20H32O3/c1-13(2)14-6-9-18(3)15(21-18)8-11-20(5)17(23-20)12-16-19(4,22-16)10-7-14/h7,10,13-17H,6,8-9,11-12H2,1-5H3 |
| InChIKey | JVANETUOFFMMFQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 37.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|