C21H37NO — CID 163129805
methanidyl-[(1R,4S)-1-methyl-4-[(2R)-4-[(1S,2R,4R)-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]butan-2-yl]cyclohex-2-en-1-yl]azanium (PubChem CID 163129805) has the molecular formula C21H37NO and a molecular weight of 319.53 g/mol. Its IUPAC name is methanidyl-[(1R,4S)-1-methyl-4-[(2R)-4-[(1S,2R,4R)-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]butan-2-yl]cyclohex-2-en-1-yl]azanium.
| Compound Name | methanidyl-[(1R,4S)-1-methyl-4-[(2R)-4-[(1S,2R,4R)-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]butan-2-yl]cyclohex-2-en-1-yl]azanium |
|---|---|
| PubChem CID | 163129805 |
| Molecular Formula | C21H37NO |
| Molecular Weight | 319.53 g/mol |
| Exact Mass | 319.29 |
| IUPAC Name | methanidyl-[(1R,4S)-1-methyl-4-[(2R)-4-[(1S,2R,4R)-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]butan-2-yl]cyclohex-2-en-1-yl]azanium |
| SMILES | [CH2-][NH2+][C@@]1(C)C=C[C@H]([C@H](C)CC[C@@H]2C(C)(C)[C@H]3CC[C@]2(C)O3)CC1 |
| InChI | InChI=1S/C21H37NO/c1-15(16-9-12-20(4,22-6)13-10-16)7-8-17-19(2,3)18-11-14-21(17,5)23-18/h9,12,15-18H,6-8,10-11,13-14,22H2,1-5H3/t15-,16+,17-,18-,20+,21+/m1/s1 |
| InChIKey | FRZJVYMWBLJWGB-KBAFEORJSA-N |
| XLogP | 4.08 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|