C16H22O2S — CID 23266700
methyl 5,5,8a-trimethyl-4a,6,7,8-tetrahydro-4H-indeno[2,1-b]thiophene-2-carboxylate (PubChem CID 23266700) has the molecular formula C16H22O2S and a molecular weight of 278.42 g/mol. Its IUPAC name is methyl 5,5,8a-trimethyl-4a,6,7,8-tetrahydro-4H-indeno[2,1-b]thiophene-2-carboxylate.
| Compound Name | methyl 5,5,8a-trimethyl-4a,6,7,8-tetrahydro-4H-indeno[2,1-b]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 23266700 |
| Molecular Formula | C16H22O2S |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | methyl 5,5,8a-trimethyl-4a,6,7,8-tetrahydro-4H-indeno[2,1-b]thiophene-2-carboxylate |
| SMILES | COC(=O)c1cc2c(s1)CC1C(C)(C)CCCC21C |
| InChI | InChI=1S/C16H22O2S/c1-15(2)6-5-7-16(3)10-8-12(14(17)18-4)19-11(10)9-13(15)16/h8,13H,5-7,9H2,1-4H3 |
| InChIKey | SZIVKWSUTZISKA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |