C19H27N3 — CID 23266875
3,3-dimethyl-1-(piperidin-1-ylmethyl)-1,2,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 23266875) has the molecular formula C19H27N3 and a molecular weight of 297.45 g/mol. Its IUPAC name is 3,3-dimethyl-1-(piperidin-1-ylmethyl)-1,2,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 3,3-dimethyl-1-(piperidin-1-ylmethyl)-1,2,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 23266875 |
| Molecular Formula | C19H27N3 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 3,3-dimethyl-1-(piperidin-1-ylmethyl)-1,2,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | CC1(C)Cc2[nH]c3ccccc3c2C(CN2CCCCC2)N1 |
| InChI | InChI=1S/C19H27N3/c1-19(2)12-16-18(14-8-4-5-9-15(14)20-16)17(21-19)13-22-10-6-3-7-11-22/h4-5,8-9,17,20-21H,3,6-7,10-13H2,1-2H3 |
| InChIKey | RITQLYJBCGQYMW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|