About ethyl 2-[methylimino-di(propan-2-yloxy)-λ5-phosphanyl]acetate
ethyl 2-[methylimino-di(propan-2-yloxy)-λ5-phosphanyl]acetate (PubChem CID 23268247) has the molecular formula C11H24NO4P
and a molecular weight of 265.29 g/mol. Its IUPAC name is ethyl 2-[methylimino-di(propan-2-yloxy)-λ5-phosphanyl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[methylimino-di(propan-2-yloxy)-λ5-phosphanyl]acetate |
| PubChem CID | 23268247 |
| Molecular Formula | C11H24NO4P |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | ethyl 2-[methylimino-di(propan-2-yloxy)-λ5-phosphanyl]acetate |
| SMILES | CCOC(=O)CP(=NC)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C11H24NO4P/c1-7-14-11(13)8-17(12-6,15-9(2)3)16-10(4)5/h9-10H,7-8H2,1-6H3 |
| InChIKey | YWGUCPRTTAFMAM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[methylimino-di(propan-2-yloxy)-λ5-phosphanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[methylimino-di(propan-2-yloxy)-λ5-phosphanyl]acetate?
The IUPAC name of ethyl 2-[methylimino-di(propan-2-yloxy)-λ5-phosphanyl]acetate (CID 23268247) is ethyl 2-[methylimino-di(propan-2-yloxy)-λ5-phosphanyl]acetate.
What is the SMILES notation for ethyl 2-[methylimino-di(propan-2-yloxy)-λ5-phosphanyl]acetate?
The canonical SMILES for ethyl 2-[methylimino-di(propan-2-yloxy)-λ5-phosphanyl]acetate is CCOC(=O)CP(=NC)(OC(C)C)OC(C)C.
What is the InChIKey of ethyl 2-[methylimino-di(propan-2-yloxy)-λ5-phosphanyl]acetate?
The InChIKey is YWGUCPRTTAFMAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24NO4P/c1-7-14-11(13)8-17(12-6,15-9(2)3)16-10(4)5/h9-10H,7-8H2,1-6H3.
What are the key properties of ethyl 2-[methylimino-di(propan-2-yloxy)-λ5-phosphanyl]acetate?
ethyl 2-[methylimino-di(propan-2-yloxy)-λ5-phosphanyl]acetate has a molecular weight of 265.29 g/mol, XLogP of 3.06, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[methylimino-di(propan-2-yloxy)-λ5-phosphanyl]acetate is sourced from PubChem (CID 23268247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).