3-(4-hydroxy-2,3,5,6-tetramethylphenyl)propanoic acid

C13H18O3 — CID 23268445

IUPAC3-(4-hydroxy-2,3,5,6-tetramethylphenyl)propanoic acid
SMILESCc1c(C)c(CCC(=O)O)c(C)c(C)c1O
InChIInChI=1S/C13H18O3/c1-7-9(3)13(16)10(4)8(2)11(7)5-6-12(14)15/h16H,5-6H2,1-4H3,(H,14,15)
InChIKeyMOOGYOZPUZESBB-UHFFFAOYSA-N
MW222.28 g/mol
LogP2.64
Rot. Bonds3

About 3-(4-hydroxy-2,3,5,6-tetramethylphenyl)propanoic acid

3-(4-hydroxy-2,3,5,6-tetramethylphenyl)propanoic acid (PubChem CID 23268445) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 3-(4-hydroxy-2,3,5,6-tetramethylphenyl)propanoic acid.

Molecular Properties

Compound Name3-(4-hydroxy-2,3,5,6-tetramethylphenyl)propanoic acid
PubChem CID23268445
Molecular FormulaC13H18O3
Molecular Weight222.28 g/mol
Exact Mass222.13
IUPAC Name3-(4-hydroxy-2,3,5,6-tetramethylphenyl)propanoic acid
SMILESCc1c(C)c(CCC(=O)O)c(C)c(C)c1O
InChIInChI=1S/C13H18O3/c1-7-9(3)13(16)10(4)8(2)11(7)5-6-12(14)15/h16H,5-6H2,1-4H3,(H,14,15)
InChIKeyMOOGYOZPUZESBB-UHFFFAOYSA-N
XLogP2.64
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.28
LogP ≤ 52.64
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(4-hydroxy-2,3,5,6-tetramethylphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-hydroxy-2,3,5,6-tetramethylphenyl)propanoic acid?
The IUPAC name of 3-(4-hydroxy-2,3,5,6-tetramethylphenyl)propanoic acid (CID 23268445) is 3-(4-hydroxy-2,3,5,6-tetramethylphenyl)propanoic acid.
What is the SMILES notation for 3-(4-hydroxy-2,3,5,6-tetramethylphenyl)propanoic acid?
The canonical SMILES for 3-(4-hydroxy-2,3,5,6-tetramethylphenyl)propanoic acid is Cc1c(C)c(CCC(=O)O)c(C)c(C)c1O.
What is the InChIKey of 3-(4-hydroxy-2,3,5,6-tetramethylphenyl)propanoic acid?
The InChIKey is MOOGYOZPUZESBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3/c1-7-9(3)13(16)10(4)8(2)11(7)5-6-12(14)15/h16H,5-6H2,1-4H3,(H,14,15).
What are the key properties of 3-(4-hydroxy-2,3,5,6-tetramethylphenyl)propanoic acid?
3-(4-hydroxy-2,3,5,6-tetramethylphenyl)propanoic acid has a molecular weight of 222.28 g/mol, XLogP of 2.64, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-hydroxy-2,3,5,6-tetramethylphenyl)propanoic acid is sourced from PubChem (CID 23268445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).