C9H12O4 — CID 23269155
1-methoxy-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-5-carbaldehyde (PubChem CID 23269155) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 1-methoxy-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-5-carbaldehyde.
| Compound Name | 1-methoxy-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-5-carbaldehyde |
|---|---|
| PubChem CID | 23269155 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 1-methoxy-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-5-carbaldehyde |
| SMILES | COC1OC(=O)C2CC(C=O)CC12 |
| InChI | InChI=1S/C9H12O4/c1-12-9-7-3-5(4-10)2-6(7)8(11)13-9/h4-7,9H,2-3H2,1H3 |
| InChIKey | VRDSZLRVMVOXKU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|