C11H16O5 — CID 25149471
ethyl (1S,3aR,6R,6aS)-1-methoxy-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-6-carboxylate (PubChem CID 25149471) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is ethyl (1S,3aR,6R,6aS)-1-methoxy-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-6-carboxylate.
| Compound Name | ethyl (1S,3aR,6R,6aS)-1-methoxy-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-6-carboxylate |
|---|---|
| PubChem CID | 25149471 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | ethyl (1S,3aR,6R,6aS)-1-methoxy-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-6-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC[C@H]2C(=O)O[C@H](OC)[C@@H]12 |
| InChI | InChI=1S/C11H16O5/c1-3-15-9(12)6-4-5-7-8(6)11(14-2)16-10(7)13/h6-8,11H,3-5H2,1-2H3/t6-,7-,8+,11+/m1/s1 |
| InChIKey | ICLSBWBKGXIDJN-LEQIOUOKSA-N |
| XLogP | 0.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |