About 2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one
2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one (PubChem CID 15807395) has the molecular formula C9H10O4
and a molecular weight of 182.17 g/mol. Its IUPAC name is 2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one.
Analyze 2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one?
The IUPAC name of 2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one (CID 15807395) is 2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one.
What is the SMILES notation for 2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one?
The canonical SMILES for 2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one is O=C1OC2OC3OCC4CC1C2C43.
What is the InChIKey of 2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one?
The InChIKey is YHHCTSOHMYWCQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4/c10-7-4-1-3-2-11-8-5(3)6(4)9(12-7)13-8/h3-6,8-9H,1-2H2.
What are the key properties of 2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one?
2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one has a molecular weight of 182.17 g/mol, XLogP of 0.12, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,8,12-trioxatetracyclo[7.2.1.04,11.06,10]dodecan-3-one is sourced from PubChem (CID 15807395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).