C9H12O5 — CID 10488240
(1R,4R,5S,7R,10S)-8-hydroxy-2,9-dioxatricyclo[5.2.1.04,10]decane-5-carboxylic acid (PubChem CID 10488240) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is (1R,4R,5S,7R,10S)-8-hydroxy-2,9-dioxatricyclo[5.2.1.04,10]decane-5-carboxylic acid.
| Compound Name | (1R,4R,5S,7R,10S)-8-hydroxy-2,9-dioxatricyclo[5.2.1.04,10]decane-5-carboxylic acid |
|---|---|
| PubChem CID | 10488240 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (1R,4R,5S,7R,10S)-8-hydroxy-2,9-dioxatricyclo[5.2.1.04,10]decane-5-carboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@H]2C(O)O[C@H]3OC[C@@H]1[C@H]32 |
| InChI | InChI=1S/C9H12O5/c10-7(11)3-1-4-6-5(3)2-13-9(6)14-8(4)12/h3-6,8-9,12H,1-2H2,(H,10,11)/t3-,4+,5-,6+,8?,9+/m0/s1 |
| InChIKey | ODTIGTSWQOBEAO-IUPLFSOZSA-N |
| XLogP | -0.36 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |