C10H12O5 — CID 139200717
(1R,2R,6R,8S,10R,14S)-5,7,9,11-tetraoxatetracyclo[6.6.0.02,6.010,14]tetradecan-4-one (PubChem CID 139200717) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is (1R,2R,6R,8S,10R,14S)-5,7,9,11-tetraoxatetracyclo[6.6.0.02,6.010,14]tetradecan-4-one.
| Compound Name | (1R,2R,6R,8S,10R,14S)-5,7,9,11-tetraoxatetracyclo[6.6.0.02,6.010,14]tetradecan-4-one |
|---|---|
| PubChem CID | 139200717 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | (1R,2R,6R,8S,10R,14S)-5,7,9,11-tetraoxatetracyclo[6.6.0.02,6.010,14]tetradecan-4-one |
| SMILES | O=C1C[C@H]2[C@@H](O1)O[C@@H]1O[C@H]3OCC[C@H]3[C@@H]12 |
| InChI | InChI=1S/C10H12O5/c11-6-3-5-7-4-1-2-12-8(4)14-10(7)15-9(5)13-6/h4-5,7-10H,1-3H2/t4-,5+,7+,8+,9-,10-/m0/s1 |
| InChIKey | OIPFSRQRKOCPOL-GECIHGONSA-N |
| XLogP | 0.24 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |