C14H16N2O — CID 23269827
4-ethoxy-1-methyl-2,3-dihydropyrrolo[2,3-b]quinoline (PubChem CID 23269827) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is 4-ethoxy-1-methyl-2,3-dihydropyrrolo[2,3-b]quinoline.
| Compound Name | 4-ethoxy-1-methyl-2,3-dihydropyrrolo[2,3-b]quinoline |
|---|---|
| PubChem CID | 23269827 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 4-ethoxy-1-methyl-2,3-dihydropyrrolo[2,3-b]quinoline |
| SMILES | CCOc1c2c(nc3ccccc13)N(C)CC2 |
| InChI | InChI=1S/C14H16N2O/c1-3-17-13-10-6-4-5-7-12(10)15-14-11(13)8-9-16(14)2/h4-7H,3,8-9H2,1-2H3 |
| InChIKey | KGHHYEFRACTPCI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |