C23H24ClN4- — CID 53347667
1-benzyl-N-(1-methyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)pyrrolidin-2-imine chloride (PubChem CID 53347667) has the molecular formula C23H24ClN4- and a molecular weight of 391.93 g/mol. Its IUPAC name is 1-benzyl-N-(1-methyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)pyrrolidin-2-imine chloride.
| Compound Name | 1-benzyl-N-(1-methyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)pyrrolidin-2-imine chloride |
|---|---|
| PubChem CID | 53347667 |
| Molecular Formula | C23H24ClN4- |
| Molecular Weight | 391.93 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 1-benzyl-N-(1-methyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-yl)pyrrolidin-2-imine chloride |
| SMILES | CN1CCc2c1nc1ccccc1c2/N=C1\CCCN1Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C23H24N4.ClH/c1-26-15-13-19-22(18-10-5-6-11-20(18)24-23(19)26)25-21-12-7-14-27(21)16-17-8-3-2-4-9-17;/h2-6,8-11H,7,12-16H2,1H3;1H/p-1/b25-21+; |
| InChIKey | YJUKURVQOSZUFR-JMFMGIQESA-M |
| XLogP | 1.56 |
| TPSA | 31.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.93 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|