C25H21ClN4O4 — CID 6611714
1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine;2-chloro-5-nitrobenzoic acid (PubChem CID 6611714) has the molecular formula C25H21ClN4O4 and a molecular weight of 476.92 g/mol. Its IUPAC name is 1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine;2-chloro-5-nitrobenzoic acid.
| Compound Name | 1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine;2-chloro-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 6611714 |
| Molecular Formula | C25H21ClN4O4 |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 1-benzyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-amine;2-chloro-5-nitrobenzoic acid |
| SMILES | Nc1c2c(nc3ccccc13)N(Cc1ccccc1)CC2.O=C(O)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C18H17N3.C7H4ClNO4/c19-17-14-8-4-5-9-16(14)20-18-15(17)10-11-21(18)12-13-6-2-1-3-7-13;8-6-2-1-4(9(12)13)3-5(6)7(10)11/h1-9H,10-12H2,(H2,19,20);1-3H,(H,10,11) |
| InChIKey | RWIVIXJOFJPJDC-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 122.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|