C13H16N2OS — CID 2327140
1-(4-ethylphenyl)-2-(2-imino-1,3-thiazolidin-3-yl)ethanone (PubChem CID 2327140) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-2-(2-imino-1,3-thiazolidin-3-yl)ethanone.
| Compound Name | 1-(4-ethylphenyl)-2-(2-imino-1,3-thiazolidin-3-yl)ethanone |
|---|---|
| PubChem CID | 2327140 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-(4-ethylphenyl)-2-(2-imino-1,3-thiazolidin-3-yl)ethanone |
| SMILES | [H]/N=C1\SCCN1CC(=O)c1ccc(CC)cc1 |
| InChI | InChI=1S/C13H16N2OS/c1-2-10-3-5-11(6-4-10)12(16)9-15-7-8-17-13(15)14/h3-6,14H,2,7-9H2,1H3/b14-13- |
| InChIKey | KBBPCAFNLRNHHW-YPKPFQOOSA-N |
| XLogP | 2.42 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|