C10H13N3 — CID 23272349
2,5-dimethyl-3-phenyl-1,3-dihydro-1,2,4-triazole (PubChem CID 23272349) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 2,5-dimethyl-3-phenyl-1,3-dihydro-1,2,4-triazole.
| Compound Name | 2,5-dimethyl-3-phenyl-1,3-dihydro-1,2,4-triazole |
|---|---|
| PubChem CID | 23272349 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2,5-dimethyl-3-phenyl-1,3-dihydro-1,2,4-triazole |
| SMILES | CC1=NC(c2ccccc2)N(C)N1 |
| InChI | InChI=1S/C10H13N3/c1-8-11-10(13(2)12-8)9-6-4-3-5-7-9/h3-7,10H,1-2H3,(H,11,12) |
| InChIKey | ZKDYCKYYYBQHNO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |