About N'-benzylethanimidamide;hydrochloride
N'-benzylethanimidamide;hydrochloride (PubChem CID 69168126) has the molecular formula C9H13ClN2
and a molecular weight of 184.67 g/mol. Its IUPAC name is N'-benzylethanimidamide;hydrochloride.
Molecular Properties
| Compound Name | N'-benzylethanimidamide;hydrochloride |
| PubChem CID | 69168126 |
| Molecular Formula | C9H13ClN2 |
| Molecular Weight | 184.67 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | N'-benzylethanimidamide;hydrochloride |
| SMILES | C/C(N)=N\Cc1ccccc1.Cl |
| InChI | InChI=1S/C9H12N2.ClH/c1-8(10)11-7-9-5-3-2-4-6-9;/h2-6H,7H2,1H3,(H2,10,11);1H |
| InChIKey | WZATYSOSTXBEJR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.67 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-benzylethanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzylethanimidamide;hydrochloride?
The IUPAC name of N'-benzylethanimidamide;hydrochloride (CID 69168126) is N'-benzylethanimidamide;hydrochloride.
What is the SMILES notation for N'-benzylethanimidamide;hydrochloride?
The canonical SMILES for N'-benzylethanimidamide;hydrochloride is C/C(N)=N\Cc1ccccc1.Cl.
What is the InChIKey of N'-benzylethanimidamide;hydrochloride?
The InChIKey is WZATYSOSTXBEJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2.ClH/c1-8(10)11-7-9-5-3-2-4-6-9;/h2-6H,7H2,1H3,(H2,10,11);1H.
What are the key properties of N'-benzylethanimidamide;hydrochloride?
N'-benzylethanimidamide;hydrochloride has a molecular weight of 184.67 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzylethanimidamide;hydrochloride is sourced from PubChem (CID 69168126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).