C10H19N5O — CID 23274327
1-hydroxy-2-imino-4-N,4-N-dipropylpyrimidine-4,6-diamine (PubChem CID 23274327) has the molecular formula C10H19N5O and a molecular weight of 225.30 g/mol. Its IUPAC name is 1-hydroxy-2-imino-4-N,4-N-dipropylpyrimidine-4,6-diamine.
| Compound Name | 1-hydroxy-2-imino-4-N,4-N-dipropylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23274327 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 1-hydroxy-2-imino-4-N,4-N-dipropylpyrimidine-4,6-diamine |
| SMILES | [H]/N=c1\nc(N(CCC)CCC)cc(N)n1O |
| InChI | InChI=1S/C10H19N5O/c1-3-5-14(6-4-2)9-7-8(11)15(16)10(12)13-9/h7,12,16H,3-6,11H2,1-2H3/b12-10+ |
| InChIKey | YXNLVJOPSBFTLN-ZRDIBKRKSA-N |
| XLogP | 0.81 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|