C10H18CuN6S2 — CID 23275296
copper N'-methyl-N-[(Z)-[(1Z)-1-[(N-methyl-C-sulfidocarbonimidoyl)hydrazinylidene]hexan-2-ylidene]amino]carbamimidothioate (PubChem CID 23275296) has the molecular formula C10H18CuN6S2 and a molecular weight of 349.98 g/mol. Its IUPAC name is copper N'-methyl-N-[(Z)-[(1Z)-1-[(N-methyl-C-sulfidocarbonimidoyl)hydrazinylidene]hexan-2-ylidene]amino]carbamimidothioate.
| Compound Name | copper N'-methyl-N-[(Z)-[(1Z)-1-[(N-methyl-C-sulfidocarbonimidoyl)hydrazinylidene]hexan-2-ylidene]amino]carbamimidothioate |
|---|---|
| PubChem CID | 23275296 |
| Molecular Formula | C10H18CuN6S2 |
| Molecular Weight | 349.98 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | copper N'-methyl-N-[(Z)-[(1Z)-1-[(N-methyl-C-sulfidocarbonimidoyl)hydrazinylidene]hexan-2-ylidene]amino]carbamimidothioate |
| SMILES | CCCCC(/C=N\N/C([S-])=N/C)=N/N/C([S-])=N/C.[Cu+2] |
| InChI | InChI=1S/C10H20N6S2.Cu/c1-4-5-6-8(14-16-10(18)12-3)7-13-15-9(17)11-2;/h7H,4-6H2,1-3H3,(H2,11,15,17)(H2,12,16,18);/q;+2/p-2/b13-7-,14-8-; |
| InChIKey | MVIVMLZZXAVGDW-QMRHWWNPSA-L |
| XLogP | 0.76 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.98 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|