C7H14N6S2 — CID 23266274
[(E)-[(1E)-1-(carbamothioylhydrazinylidene)pentan-2-ylidene]amino]thiourea (PubChem CID 23266274) has the molecular formula C7H14N6S2 and a molecular weight of 246.36 g/mol. Its IUPAC name is [(E)-[(1E)-1-(carbamothioylhydrazinylidene)pentan-2-ylidene]amino]thiourea.
| Compound Name | [(E)-[(1E)-1-(carbamothioylhydrazinylidene)pentan-2-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 23266274 |
| Molecular Formula | C7H14N6S2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | [(E)-[(1E)-1-(carbamothioylhydrazinylidene)pentan-2-ylidene]amino]thiourea |
| SMILES | CCCC(/C=N/NC(N)=S)=N\NC(N)=S |
| InChI | InChI=1S/C7H14N6S2/c1-2-3-5(11-13-7(9)15)4-10-12-6(8)14/h4H,2-3H2,1H3,(H3,8,12,14)(H3,9,13,15)/b10-4+,11-5+ |
| InChIKey | JRQHIXBBLQIUPS-ZVSIBQGLSA-N |
| XLogP | -0.21 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|