C8H16N6O3S2 — CID 98540263
[(E)-[(1Z,4S,5R)-1-(carbamothioylhydrazinylidene)-4,5,6-trihydroxyhexan-2-ylidene]amino]thiourea (PubChem CID 98540263) has the molecular formula C8H16N6O3S2 and a molecular weight of 308.39 g/mol. Its IUPAC name is [(E)-[(1Z,4S,5R)-1-(carbamothioylhydrazinylidene)-4,5,6-trihydroxyhexan-2-ylidene]amino]thiourea.
| Compound Name | [(E)-[(1Z,4S,5R)-1-(carbamothioylhydrazinylidene)-4,5,6-trihydroxyhexan-2-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 98540263 |
| Molecular Formula | C8H16N6O3S2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | [(E)-[(1Z,4S,5R)-1-(carbamothioylhydrazinylidene)-4,5,6-trihydroxyhexan-2-ylidene]amino]thiourea |
| SMILES | NC(=S)N/N=C\C(C[C@H](O)[C@H](O)CO)=N\NC(N)=S |
| InChI | InChI=1S/C8H16N6O3S2/c9-7(18)13-11-2-4(12-14-8(10)19)1-5(16)6(17)3-15/h2,5-6,15-17H,1,3H2,(H3,9,13,18)(H3,10,14,19)/b11-2-,12-4+/t5-,6+/m0/s1 |
| InChIKey | PNSVYDQCLLYORN-BJVNPULRSA-N |
| XLogP | -2.90 |
| TPSA | 161.51 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|