C12H25N3S — CID 121266890
(2,3,3-triethylpentylideneamino)thiourea (PubChem CID 121266890) has the molecular formula C12H25N3S and a molecular weight of 243.42 g/mol. Its IUPAC name is (2,3,3-triethylpentylideneamino)thiourea.
| Compound Name | (2,3,3-triethylpentylideneamino)thiourea |
|---|---|
| PubChem CID | 121266890 |
| Molecular Formula | C12H25N3S |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | (2,3,3-triethylpentylideneamino)thiourea |
| SMILES | CCC(C=NNC(N)=S)C(CC)(CC)CC |
| InChI | InChI=1S/C12H25N3S/c1-5-10(9-14-15-11(13)16)12(6-2,7-3)8-4/h9-10H,5-8H2,1-4H3,(H3,13,15,16) |
| InChIKey | UQCPFBTWTSMJQD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|