C7H16N6S2 — CID 172974668
[(E)-[(2E)-2-(carbamothioylhydrazinylidene)ethylidene]amino]thiourea;propane (PubChem CID 172974668) has the molecular formula C7H16N6S2 and a molecular weight of 248.38 g/mol. Its IUPAC name is [(E)-[(2E)-2-(carbamothioylhydrazinylidene)ethylidene]amino]thiourea;propane.
| Compound Name | [(E)-[(2E)-2-(carbamothioylhydrazinylidene)ethylidene]amino]thiourea;propane |
|---|---|
| PubChem CID | 172974668 |
| Molecular Formula | C7H16N6S2 |
| Molecular Weight | 248.38 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | [(E)-[(2E)-2-(carbamothioylhydrazinylidene)ethylidene]amino]thiourea;propane |
| SMILES | CCC.NC(=S)N/N=C/C=N/NC(N)=S |
| InChI | InChI=1S/C4H8N6S2.C3H8/c5-3(11)9-7-1-2-8-10-4(6)12;1-3-2/h1-2H,(H3,5,9,11)(H3,6,10,12);3H2,1-2H3/b7-1+,8-2+; |
| InChIKey | FQKFTMBXHJCDOL-SFEXJBTNSA-N |
| XLogP | 0.04 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.38 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|