C11H17F6N3OS — CID 3004645
[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)heptylideneamino]thiourea (PubChem CID 3004645) has the molecular formula C11H17F6N3OS and a molecular weight of 353.33 g/mol. Its IUPAC name is [2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)heptylideneamino]thiourea.
| Compound Name | [2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)heptylideneamino]thiourea |
|---|---|
| PubChem CID | 3004645 |
| Molecular Formula | C11H17F6N3OS |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | [2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)heptylideneamino]thiourea |
| SMILES | CCCCCC(C=NNC(N)=S)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H17F6N3OS/c1-2-3-4-5-7(6-19-20-8(18)22)9(21,10(12,13)14)11(15,16)17/h6-7,21H,2-5H2,1H3,(H3,18,20,22) |
| InChIKey | GKGNUCJQSXGTOC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|