C14H33N5S2 — CID 139062015
N'-(carbamothioylamino)carbamimidothioate;tetrapropylazanium (PubChem CID 139062015) has the molecular formula C14H33N5S2 and a molecular weight of 335.59 g/mol. Its IUPAC name is N'-(carbamothioylamino)carbamimidothioate;tetrapropylazanium.
| Compound Name | N'-(carbamothioylamino)carbamimidothioate;tetrapropylazanium |
|---|---|
| PubChem CID | 139062015 |
| Molecular Formula | C14H33N5S2 |
| Molecular Weight | 335.59 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | N'-(carbamothioylamino)carbamimidothioate;tetrapropylazanium |
| SMILES | CCC[N+](CCC)(CCC)CCC.NC(=S)N/N=C(/N)[S-] |
| InChI | InChI=1S/C12H28N.C2H6N4S2/c1-5-9-13(10-6-2,11-7-3)12-8-4;3-1(7)5-6-2(4)8/h5-12H2,1-4H3;(H3,3,5,7)(H3,4,6,8)/q+1;/p-1 |
| InChIKey | KYDPKBMGTHMDOX-UHFFFAOYSA-M |
| XLogP | 2.04 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.59 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|