C16H21Cl2N3S — CID 131859994
[[(E)-1-(3,4-dichlorophenyl)non-1-en-3-ylidene]amino]thiourea (PubChem CID 131859994) has the molecular formula C16H21Cl2N3S and a molecular weight of 358.34 g/mol. Its IUPAC name is [[(E)-1-(3,4-dichlorophenyl)non-1-en-3-ylidene]amino]thiourea.
| Compound Name | [[(E)-1-(3,4-dichlorophenyl)non-1-en-3-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 131859994 |
| Molecular Formula | C16H21Cl2N3S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | [[(E)-1-(3,4-dichlorophenyl)non-1-en-3-ylidene]amino]thiourea |
| SMILES | CCCCCCC(/C=C/c1ccc(Cl)c(Cl)c1)=NNC(N)=S |
| InChI | InChI=1S/C16H21Cl2N3S/c1-2-3-4-5-6-13(20-21-16(19)22)9-7-12-8-10-14(17)15(18)11-12/h7-11H,2-6H2,1H3,(H3,19,21,22)/b9-7+,20-13? |
| InChIKey | YRHMFELWQFBOTP-FHLDBLRDSA-N |
| XLogP | 5.17 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|