C22H26Cl3N3O — CID 54607420
N-[(E)-[(E)-1-(3,4-dichlorophenyl)non-1-en-3-ylidene]amino]-2-pyridin-1-ium-1-ylacetamide chloride (PubChem CID 54607420) has the molecular formula C22H26Cl3N3O and a molecular weight of 454.83 g/mol. Its IUPAC name is N-[(E)-[(E)-1-(3,4-dichlorophenyl)non-1-en-3-ylidene]amino]-2-pyridin-1-ium-1-ylacetamide chloride.
| Compound Name | N-[(E)-[(E)-1-(3,4-dichlorophenyl)non-1-en-3-ylidene]amino]-2-pyridin-1-ium-1-ylacetamide chloride |
|---|---|
| PubChem CID | 54607420 |
| Molecular Formula | C22H26Cl3N3O |
| Molecular Weight | 454.83 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | N-[(E)-[(E)-1-(3,4-dichlorophenyl)non-1-en-3-ylidene]amino]-2-pyridin-1-ium-1-ylacetamide chloride |
| SMILES | CCCCCCC(/C=C/c1ccc(Cl)c(Cl)c1)=N\NC(=O)C[n+]1ccccc1.[Cl-] |
| InChI | InChI=1S/C22H25Cl2N3O.ClH/c1-2-3-4-6-9-19(12-10-18-11-13-20(23)21(24)16-18)25-26-22(28)17-27-14-7-5-8-15-27;/h5,7-8,10-16H,2-4,6,9,17H2,1H3;1H/b12-10+,25-19+; |
| InChIKey | MRONQWURECLAOC-CRZWJEECSA-N |
| XLogP | 2.44 |
| TPSA | 45.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.83 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|