C20H30Cl2N3O+ — CID 131885495
[2-[2-[(E)-1-(3,4-dichlorophenyl)non-1-en-3-ylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium (PubChem CID 131885495) has the molecular formula C20H30Cl2N3O+ and a molecular weight of 399.39 g/mol. Its IUPAC name is [2-[2-[(E)-1-(3,4-dichlorophenyl)non-1-en-3-ylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium.
| Compound Name | [2-[2-[(E)-1-(3,4-dichlorophenyl)non-1-en-3-ylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium |
|---|---|
| PubChem CID | 131885495 |
| Molecular Formula | C20H30Cl2N3O+ |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [2-[2-[(E)-1-(3,4-dichlorophenyl)non-1-en-3-ylidene]hydrazinyl]-2-oxoethyl]-trimethylazanium |
| SMILES | CCCCCCC(/C=C/c1ccc(Cl)c(Cl)c1)=NNC(=O)C[N+](C)(C)C |
| InChI | InChI=1S/C20H29Cl2N3O/c1-5-6-7-8-9-17(23-24-20(26)15-25(2,3)4)12-10-16-11-13-18(21)19(22)14-16/h10-14H,5-9,15H2,1-4H3/p+1/b12-10+,23-17? |
| InChIKey | YYSKFWJSNVCJED-OGTQSECRSA-O |
| XLogP | 5.16 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|