C21H19Cl2F5N2 — CID 92528675
N-[(E)-[(Z)-1-(3,4-dichlorophenyl)non-1-en-3-ylidene]amino]-2,3,4,5,6-pentafluoroaniline (PubChem CID 92528675) has the molecular formula C21H19Cl2F5N2 and a molecular weight of 465.29 g/mol. Its IUPAC name is N-[(E)-[(Z)-1-(3,4-dichlorophenyl)non-1-en-3-ylidene]amino]-2,3,4,5,6-pentafluoroaniline.
| Compound Name | N-[(E)-[(Z)-1-(3,4-dichlorophenyl)non-1-en-3-ylidene]amino]-2,3,4,5,6-pentafluoroaniline |
|---|---|
| PubChem CID | 92528675 |
| Molecular Formula | C21H19Cl2F5N2 |
| Molecular Weight | 465.29 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | N-[(E)-[(Z)-1-(3,4-dichlorophenyl)non-1-en-3-ylidene]amino]-2,3,4,5,6-pentafluoroaniline |
| SMILES | CCCCCCC(/C=C\c1ccc(Cl)c(Cl)c1)=N\Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H19Cl2F5N2/c1-2-3-4-5-6-13(9-7-12-8-10-14(22)15(23)11-12)29-30-21-19(27)17(25)16(24)18(26)20(21)28/h7-11,30H,2-6H2,1H3/b9-7-,29-13+ |
| InChIKey | CLGVMPBHQNATGJ-YRWQBFDQSA-N |
| XLogP | 8.14 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.29 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|