C12H15Cl3N2 — CID 23469646
N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]butanimidamide;hydrochloride (PubChem CID 23469646) has the molecular formula C12H15Cl3N2 and a molecular weight of 293.62 g/mol. Its IUPAC name is N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]butanimidamide;hydrochloride.
| Compound Name | N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]butanimidamide;hydrochloride |
|---|---|
| PubChem CID | 23469646 |
| Molecular Formula | C12H15Cl3N2 |
| Molecular Weight | 293.62 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]butanimidamide;hydrochloride |
| SMILES | CCC/C(N)=N\C=C\c1ccc(Cl)c(Cl)c1.Cl |
| InChI | InChI=1S/C12H14Cl2N2.ClH/c1-2-3-12(15)16-7-6-9-4-5-10(13)11(14)8-9;/h4-8H,2-3H2,1H3,(H2,15,16);1H/b7-6+; |
| InChIKey | SSWFAKNDAFGWPG-UHDJGPCESA-N |
| XLogP | 4.54 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.62 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|