C11H13Cl3N2 — CID 74054388
N'-[2-(3,4-dichlorophenyl)ethenyl]propanimidamide;hydrochloride (PubChem CID 74054388) has the molecular formula C11H13Cl3N2 and a molecular weight of 279.60 g/mol. Its IUPAC name is N'-[2-(3,4-dichlorophenyl)ethenyl]propanimidamide;hydrochloride.
| Compound Name | N'-[2-(3,4-dichlorophenyl)ethenyl]propanimidamide;hydrochloride |
|---|---|
| PubChem CID | 74054388 |
| Molecular Formula | C11H13Cl3N2 |
| Molecular Weight | 279.60 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | N'-[2-(3,4-dichlorophenyl)ethenyl]propanimidamide;hydrochloride |
| SMILES | CC/C(N)=N\C=Cc1ccc(Cl)c(Cl)c1.Cl |
| InChI | InChI=1S/C11H12Cl2N2.ClH/c1-2-11(14)15-6-5-8-3-4-9(12)10(13)7-8;/h3-7H,2H2,1H3,(H2,14,15);1H |
| InChIKey | VXHKZTNMICHGNR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.60 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|