C13H16Cl2N2 — CID 23469608
N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]-3-methylbutanimidamide (PubChem CID 23469608) has the molecular formula C13H16Cl2N2 and a molecular weight of 271.19 g/mol. Its IUPAC name is N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]-3-methylbutanimidamide.
| Compound Name | N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]-3-methylbutanimidamide |
|---|---|
| PubChem CID | 23469608 |
| Molecular Formula | C13H16Cl2N2 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]-3-methylbutanimidamide |
| SMILES | CC(C)C/C(N)=N\C=C\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H16Cl2N2/c1-9(2)7-13(16)17-6-5-10-3-4-11(14)12(15)8-10/h3-6,8-9H,7H2,1-2H3,(H2,16,17)/b6-5+ |
| InChIKey | NWBLSIKTMAVXMB-AATRIKPKSA-N |
| XLogP | 4.37 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|