C12H14Cl2N2O2S — CID 70566201
N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylbutanimidamide (PubChem CID 70566201) has the molecular formula C12H14Cl2N2O2S and a molecular weight of 321.23 g/mol. Its IUPAC name is N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylbutanimidamide.
| Compound Name | N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylbutanimidamide |
|---|---|
| PubChem CID | 70566201 |
| Molecular Formula | C12H14Cl2N2O2S |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylbutanimidamide |
| SMILES | CCCC(N)=NS(=O)(=O)/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2N2O2S/c1-2-3-12(15)16-19(17,18)7-6-9-4-5-10(13)11(14)8-9/h4-8H,2-3H2,1H3,(H2,15,16)/b7-6+ |
| InChIKey | IMFDECWYMBMWHK-VOTSOKGWSA-N |
| XLogP | 3.45 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|