About N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclopentanecarboximidamide
N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclopentanecarboximidamide (PubChem CID 70566852) has the molecular formula C14H16Cl2N2O2S
and a molecular weight of 347.27 g/mol. Its IUPAC name is N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclopentanecarboximidamide.
Molecular Properties
| Compound Name | N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclopentanecarboximidamide |
| PubChem CID | 70566852 |
| Molecular Formula | C14H16Cl2N2O2S |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclopentanecarboximidamide |
| SMILES | NC(=NS(=O)(=O)/C=C/c1ccc(Cl)c(Cl)c1)C1CCCC1 |
| InChI | InChI=1S/C14H16Cl2N2O2S/c15-12-6-5-10(9-13(12)16)7-8-21(19,20)18-14(17)11-3-1-2-4-11/h5-9,11H,1-4H2,(H2,17,18)/b8-7+ |
| InChIKey | CZSRGRQVFAVYBW-BQYQJAHWSA-N |
| XLogP | 3.84 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclopentanecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclopentanecarboximidamide?
The IUPAC name of N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclopentanecarboximidamide (CID 70566852) is N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclopentanecarboximidamide.
What is the SMILES notation for N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclopentanecarboximidamide?
The canonical SMILES for N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclopentanecarboximidamide is NC(=NS(=O)(=O)/C=C/c1ccc(Cl)c(Cl)c1)C1CCCC1.
What is the InChIKey of N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclopentanecarboximidamide?
The InChIKey is CZSRGRQVFAVYBW-BQYQJAHWSA-N. The full InChI is InChI=1S/C14H16Cl2N2O2S/c15-12-6-5-10(9-13(12)16)7-8-21(19,20)18-14(17)11-3-1-2-4-11/h5-9,11H,1-4H2,(H2,17,18)/b8-7+.
What are the key properties of N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclopentanecarboximidamide?
N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclopentanecarboximidamide has a molecular weight of 347.27 g/mol, XLogP of 3.84, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclopentanecarboximidamide is sourced from PubChem (CID 70566852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).