C17H16Cl2N2 — CID 92529506
3,4-dichloro-N-[(Z)-[(Z)-1-phenylpent-1-en-3-ylidene]amino]aniline (PubChem CID 92529506) has the molecular formula C17H16Cl2N2 and a molecular weight of 319.24 g/mol. Its IUPAC name is 3,4-dichloro-N-[(Z)-[(Z)-1-phenylpent-1-en-3-ylidene]amino]aniline.
| Compound Name | 3,4-dichloro-N-[(Z)-[(Z)-1-phenylpent-1-en-3-ylidene]amino]aniline |
|---|---|
| PubChem CID | 92529506 |
| Molecular Formula | C17H16Cl2N2 |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 3,4-dichloro-N-[(Z)-[(Z)-1-phenylpent-1-en-3-ylidene]amino]aniline |
| SMILES | CCC(/C=C\c1ccccc1)=N/Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N2/c1-2-14(9-8-13-6-4-3-5-7-13)20-21-15-10-11-16(18)17(19)12-15/h3-12,21H,2H2,1H3/b9-8-,20-14- |
| InChIKey | LTTOUUHVKAYFKL-ZHBDLUIPSA-N |
| XLogP | 5.88 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|