About 2-ethoxy-3H-indole
2-ethoxy-3H-indole (PubChem CID 23279270) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 2-ethoxy-3H-indole.
Molecular Properties
| Compound Name | 2-ethoxy-3H-indole |
| PubChem CID | 23279270 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 2-ethoxy-3H-indole |
| SMILES | CCOC1=Nc2ccccc2C1 |
| InChI | InChI=1S/C10H11NO/c1-2-12-10-7-8-5-3-4-6-9(8)11-10/h3-6H,2,7H2,1H3 |
| InChIKey | QEMOVVPIVSKMNI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethoxy-3H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-3H-indole?
The IUPAC name of 2-ethoxy-3H-indole (CID 23279270) is 2-ethoxy-3H-indole.
What is the SMILES notation for 2-ethoxy-3H-indole?
The canonical SMILES for 2-ethoxy-3H-indole is CCOC1=Nc2ccccc2C1.
What is the InChIKey of 2-ethoxy-3H-indole?
The InChIKey is QEMOVVPIVSKMNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO/c1-2-12-10-7-8-5-3-4-6-9(8)11-10/h3-6H,2,7H2,1H3.
What are the key properties of 2-ethoxy-3H-indole?
2-ethoxy-3H-indole has a molecular weight of 161.20 g/mol, XLogP of 2.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3H-indole is sourced from PubChem (CID 23279270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).