C10H21O6P — CID 23280229
1-(5-ethyl-2,2,2-trimethoxy-4-methyl-1,3,2λ5-dioxaphospholan-4-yl)ethanone (PubChem CID 23280229) has the molecular formula C10H21O6P and a molecular weight of 268.25 g/mol. Its IUPAC name is 1-(5-ethyl-2,2,2-trimethoxy-4-methyl-1,3,2λ5-dioxaphospholan-4-yl)ethanone.
| Compound Name | 1-(5-ethyl-2,2,2-trimethoxy-4-methyl-1,3,2λ5-dioxaphospholan-4-yl)ethanone |
|---|---|
| PubChem CID | 23280229 |
| Molecular Formula | C10H21O6P |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-(5-ethyl-2,2,2-trimethoxy-4-methyl-1,3,2λ5-dioxaphospholan-4-yl)ethanone |
| SMILES | CCC1OP(OC)(OC)(OC)OC1(C)C(C)=O |
| InChI | InChI=1S/C10H21O6P/c1-7-9-10(3,8(2)11)16-17(12-4,13-5,14-6)15-9/h9H,7H2,1-6H3 |
| InChIKey | UYMUDEPJYQNSFL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|