C22H21N3O3S — CID 2328219
[4-[(4R,4aS)-7,7-dimethyl-5-oxo-2-sulfanylidene-3,4,4a,6-tetrahydro-1H-quinazolin-4-yl]phenyl] pyridine-3-carboxylate (PubChem CID 2328219) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is [4-[(4R,4aS)-7,7-dimethyl-5-oxo-2-sulfanylidene-3,4,4a,6-tetrahydro-1H-quinazolin-4-yl]phenyl] pyridine-3-carboxylate.
| Compound Name | [4-[(4R,4aS)-7,7-dimethyl-5-oxo-2-sulfanylidene-3,4,4a,6-tetrahydro-1H-quinazolin-4-yl]phenyl] pyridine-3-carboxylate |
|---|---|
| PubChem CID | 2328219 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | [4-[(4R,4aS)-7,7-dimethyl-5-oxo-2-sulfanylidene-3,4,4a,6-tetrahydro-1H-quinazolin-4-yl]phenyl] pyridine-3-carboxylate |
| SMILES | CC1(C)C=C2NC(=S)N[C@@H](c3ccc(OC(=O)c4cccnc4)cc3)[C@@H]2C(=O)C1 |
| InChI | InChI=1S/C22H21N3O3S/c1-22(2)10-16-18(17(26)11-22)19(25-21(29)24-16)13-5-7-15(8-6-13)28-20(27)14-4-3-9-23-12-14/h3-10,12,18-19H,11H2,1-2H3,(H2,24,25,29)/t18-,19-/m0/s1 |
| InChIKey | UZWMDUVXTIUIOX-OALUTQOASA-N |
| XLogP | 3.32 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|