C20H20N6O5S — CID 23285527
5-[5-(4-aminophenyl)sulfanyltetrazol-2-yl]-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 23285527) has the molecular formula C20H20N6O5S and a molecular weight of 456.48 g/mol. Its IUPAC name is 5-[5-(4-aminophenyl)sulfanyltetrazol-2-yl]-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 5-[5-(4-aminophenyl)sulfanyltetrazol-2-yl]-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 23285527 |
| Molecular Formula | C20H20N6O5S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 5-[5-(4-aminophenyl)sulfanyltetrazol-2-yl]-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | Nc1ccc(Sc2nnn(CC(=O)C(CC(=O)O)NC(=O)OCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H20N6O5S/c21-14-6-8-15(9-7-14)32-19-23-25-26(24-19)11-17(27)16(10-18(28)29)22-20(30)31-12-13-4-2-1-3-5-13/h1-9,16H,10-12,21H2,(H,22,30)(H,28,29) |
| InChIKey | UFFNIEKUPOTAOH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 162.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|