C19H18N6O5 — CID 54038131
4-oxo-3-(phenylmethoxycarbonylamino)-5-(5-pyridin-4-yltetrazol-1-yl)pentanoic acid (PubChem CID 54038131) has the molecular formula C19H18N6O5 and a molecular weight of 410.39 g/mol. Its IUPAC name is 4-oxo-3-(phenylmethoxycarbonylamino)-5-(5-pyridin-4-yltetrazol-1-yl)pentanoic acid.
| Compound Name | 4-oxo-3-(phenylmethoxycarbonylamino)-5-(5-pyridin-4-yltetrazol-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 54038131 |
| Molecular Formula | C19H18N6O5 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 4-oxo-3-(phenylmethoxycarbonylamino)-5-(5-pyridin-4-yltetrazol-1-yl)pentanoic acid |
| SMILES | O=C(O)CC(NC(=O)OCc1ccccc1)C(=O)Cn1nnnc1-c1ccncc1 |
| InChI | InChI=1S/C19H18N6O5/c26-16(11-25-18(22-23-24-25)14-6-8-20-9-7-14)15(10-17(27)28)21-19(29)30-12-13-4-2-1-3-5-13/h1-9,15H,10-12H2,(H,21,29)(H,27,28) |
| InChIKey | LKKKDLUKSWANFU-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 149.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |