C16H19N5O6S — CID 23285576
5-(5-ethylsulfinyltetrazol-1-yl)-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 23285576) has the molecular formula C16H19N5O6S and a molecular weight of 409.42 g/mol. Its IUPAC name is 5-(5-ethylsulfinyltetrazol-1-yl)-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 5-(5-ethylsulfinyltetrazol-1-yl)-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 23285576 |
| Molecular Formula | C16H19N5O6S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 5-(5-ethylsulfinyltetrazol-1-yl)-4-oxo-3-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | CCS(=O)c1nnnn1CC(=O)C(CC(=O)O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H19N5O6S/c1-2-28(26)15-18-19-20-21(15)9-13(22)12(8-14(23)24)17-16(25)27-10-11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3,(H,17,25)(H,23,24) |
| InChIKey | RQWYHOGFUWGUKG-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 153.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |