C20H16Cl3N5O5S — CID 23285557
4-oxo-3-(phenylmethoxycarbonylamino)-5-[5-(2,3,6-trichlorophenyl)sulfanyltetrazol-1-yl]pentanoic acid (PubChem CID 23285557) has the molecular formula C20H16Cl3N5O5S and a molecular weight of 544.80 g/mol. Its IUPAC name is 4-oxo-3-(phenylmethoxycarbonylamino)-5-[5-(2,3,6-trichlorophenyl)sulfanyltetrazol-1-yl]pentanoic acid.
| Compound Name | 4-oxo-3-(phenylmethoxycarbonylamino)-5-[5-(2,3,6-trichlorophenyl)sulfanyltetrazol-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 23285557 |
| Molecular Formula | C20H16Cl3N5O5S |
| Molecular Weight | 544.80 g/mol |
| Exact Mass | 542.99 |
| IUPAC Name | 4-oxo-3-(phenylmethoxycarbonylamino)-5-[5-(2,3,6-trichlorophenyl)sulfanyltetrazol-1-yl]pentanoic acid |
| SMILES | O=C(O)CC(NC(=O)OCc1ccccc1)C(=O)Cn1nnnc1Sc1c(Cl)ccc(Cl)c1Cl |
| InChI | InChI=1S/C20H16Cl3N5O5S/c21-12-6-7-13(22)18(17(12)23)34-19-25-26-27-28(19)9-15(29)14(8-16(30)31)24-20(32)33-10-11-4-2-1-3-5-11/h1-7,14H,8-10H2,(H,24,32)(H,30,31) |
| InChIKey | KOCCZEPHGLFWKI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.80 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|