C20H17Cl2N5O4S2 — CID 18726026
3-(benzylsulfanylcarbonylamino)-5-[5-(2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-4-oxopentanoic acid (PubChem CID 18726026) has the molecular formula C20H17Cl2N5O4S2 and a molecular weight of 526.43 g/mol. Its IUPAC name is 3-(benzylsulfanylcarbonylamino)-5-[5-(2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-4-oxopentanoic acid.
| Compound Name | 3-(benzylsulfanylcarbonylamino)-5-[5-(2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 18726026 |
| Molecular Formula | C20H17Cl2N5O4S2 |
| Molecular Weight | 526.43 g/mol |
| Exact Mass | 525.01 |
| IUPAC Name | 3-(benzylsulfanylcarbonylamino)-5-[5-(2,6-dichlorophenyl)sulfanyltetrazol-1-yl]-4-oxopentanoic acid |
| SMILES | O=C(O)CC(NC(=O)SCc1ccccc1)C(=O)Cn1nnnc1Sc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C20H17Cl2N5O4S2/c21-13-7-4-8-14(22)18(13)33-19-24-25-26-27(19)10-16(28)15(9-17(29)30)23-20(31)32-11-12-5-2-1-3-6-12/h1-8,15H,9-11H2,(H,23,31)(H,29,30) |
| InChIKey | FJCSDZFHIBUEAG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|