C23H27N5O3S — CID 18726201
benzyl N-[2-oxo-1-[5-(4-propan-2-ylphenyl)sulfanyltetrazol-1-yl]pentan-3-yl]carbamate (PubChem CID 18726201) has the molecular formula C23H27N5O3S and a molecular weight of 453.57 g/mol. Its IUPAC name is benzyl N-[2-oxo-1-[5-(4-propan-2-ylphenyl)sulfanyltetrazol-1-yl]pentan-3-yl]carbamate.
| Compound Name | benzyl N-[2-oxo-1-[5-(4-propan-2-ylphenyl)sulfanyltetrazol-1-yl]pentan-3-yl]carbamate |
|---|---|
| PubChem CID | 18726201 |
| Molecular Formula | C23H27N5O3S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | benzyl N-[2-oxo-1-[5-(4-propan-2-ylphenyl)sulfanyltetrazol-1-yl]pentan-3-yl]carbamate |
| SMILES | CCC(NC(=O)OCc1ccccc1)C(=O)Cn1nnnc1Sc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C23H27N5O3S/c1-4-20(24-23(30)31-15-17-8-6-5-7-9-17)21(29)14-28-22(25-26-27-28)32-19-12-10-18(11-13-19)16(2)3/h5-13,16,20H,4,14-15H2,1-3H3,(H,24,30) |
| InChIKey | OWZHBUSOVPUGRR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |