C20H20N6O5S — CID 18726208
benzyl N-[1-[5-(4-nitrophenyl)sulfanyltetrazol-2-yl]-2-oxopentan-3-yl]carbamate (PubChem CID 18726208) has the molecular formula C20H20N6O5S and a molecular weight of 456.48 g/mol. Its IUPAC name is benzyl N-[1-[5-(4-nitrophenyl)sulfanyltetrazol-2-yl]-2-oxopentan-3-yl]carbamate.
| Compound Name | benzyl N-[1-[5-(4-nitrophenyl)sulfanyltetrazol-2-yl]-2-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 18726208 |
| Molecular Formula | C20H20N6O5S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | benzyl N-[1-[5-(4-nitrophenyl)sulfanyltetrazol-2-yl]-2-oxopentan-3-yl]carbamate |
| SMILES | CCC(NC(=O)OCc1ccccc1)C(=O)Cn1nnc(Sc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C20H20N6O5S/c1-2-17(21-20(28)31-13-14-6-4-3-5-7-14)18(27)12-25-23-19(22-24-25)32-16-10-8-15(9-11-16)26(29)30/h3-11,17H,2,12-13H2,1H3,(H,21,28) |
| InChIKey | DJKLYVKELCZOBE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|